C11H10ClN3O3 — CID 107461164
2-[1-(2-chloro-5-methoxyphenyl)triazol-4-yl]acetic acid (PubChem CID 107461164) has the molecular formula C11H10ClN3O3 and a molecular weight of 267.67 g/mol. Its IUPAC name is 2-[1-(2-chloro-5-methoxyphenyl)triazol-4-yl]acetic acid.
| Compound Name | 2-[1-(2-chloro-5-methoxyphenyl)triazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 107461164 |
| Molecular Formula | C11H10ClN3O3 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 2-[1-(2-chloro-5-methoxyphenyl)triazol-4-yl]acetic acid |
| SMILES | COc1ccc(Cl)c(-n2cc(CC(=O)O)nn2)c1 |
| InChI | InChI=1S/C11H10ClN3O3/c1-18-8-2-3-9(12)10(5-8)15-6-7(13-14-15)4-11(16)17/h2-3,5-6H,4H2,1H3,(H,16,17) |
| InChIKey | RLGYDEJCBDVWAN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |