C11H9Cl2N3O2 — CID 82369431
3-[1-(2,5-dichlorophenyl)triazol-4-yl]propanoic acid (PubChem CID 82369431) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is 3-[1-(2,5-dichlorophenyl)triazol-4-yl]propanoic acid.
| Compound Name | 3-[1-(2,5-dichlorophenyl)triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 82369431 |
| Molecular Formula | C11H9Cl2N3O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 3-[1-(2,5-dichlorophenyl)triazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1cn(-c2cc(Cl)ccc2Cl)nn1 |
| InChI | InChI=1S/C11H9Cl2N3O2/c12-7-1-3-9(13)10(5-7)16-6-8(14-15-16)2-4-11(17)18/h1,3,5-6H,2,4H2,(H,17,18) |
| InChIKey | GDSIECRBPROCTJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |