3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid

C11H8Cl2N4O4 — CID 107460478

IUPAC3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid
SMILESO=C(O)CCc1cn(-c2c(Cl)cc(Cl)cc2[N+](=O)[O-])nn1
InChIInChI=1S/C11H8Cl2N4O4/c12-6-3-8(13)11(9(4-6)17(20)21)16-5-7(14-15-16)1-2-10(18)19/h3-5H,1-2H2,(H,18,19)
InChIKeyOKTJQYPGHPXGOV-UHFFFAOYSA-N
MW331.12 g/mol
LogP2.50
Rot. Bonds5

About 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid

3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid (PubChem CID 107460478) has the molecular formula C11H8Cl2N4O4 and a molecular weight of 331.12 g/mol. Its IUPAC name is 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid
PubChem CID107460478
Molecular FormulaC11H8Cl2N4O4
Molecular Weight331.12 g/mol
Exact Mass329.99
IUPAC Name3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid
SMILESO=C(O)CCc1cn(-c2c(Cl)cc(Cl)cc2[N+](=O)[O-])nn1
InChIInChI=1S/C11H8Cl2N4O4/c12-6-3-8(13)11(9(4-6)17(20)21)16-5-7(14-15-16)1-2-10(18)19/h3-5H,1-2H2,(H,18,19)
InChIKeyOKTJQYPGHPXGOV-UHFFFAOYSA-N
XLogP2.50
TPSA111.15 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.12
LogP ≤ 52.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid?
The IUPAC name of 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid (CID 107460478) is 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid?
The canonical SMILES for 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid is O=C(O)CCc1cn(-c2c(Cl)cc(Cl)cc2[N+](=O)[O-])nn1.
What is the InChIKey of 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid?
The InChIKey is OKTJQYPGHPXGOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl2N4O4/c12-6-3-8(13)11(9(4-6)17(20)21)16-5-7(14-15-16)1-2-10(18)19/h3-5H,1-2H2,(H,18,19).
What are the key properties of 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid?
3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid has a molecular weight of 331.12 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid is sourced from PubChem (CID 107460478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).