C11H8Cl2N4O4 — CID 107460478
3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid (PubChem CID 107460478) has the molecular formula C11H8Cl2N4O4 and a molecular weight of 331.12 g/mol. Its IUPAC name is 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid.
| Compound Name | 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 107460478 |
| Molecular Formula | C11H8Cl2N4O4 |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 3-[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1cn(-c2c(Cl)cc(Cl)cc2[N+](=O)[O-])nn1 |
| InChI | InChI=1S/C11H8Cl2N4O4/c12-6-3-8(13)11(9(4-6)17(20)21)16-5-7(14-15-16)1-2-10(18)19/h3-5H,1-2H2,(H,18,19) |
| InChIKey | OKTJQYPGHPXGOV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|