C9H7Cl2N5O2 — CID 62056002
[1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]methanamine (PubChem CID 62056002) has the molecular formula C9H7Cl2N5O2 and a molecular weight of 288.09 g/mol. Its IUPAC name is [1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]methanamine.
| Compound Name | [1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 62056002 |
| Molecular Formula | C9H7Cl2N5O2 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | [1-(2,4-dichloro-6-nitrophenyl)triazol-4-yl]methanamine |
| SMILES | NCc1cn(-c2c(Cl)cc(Cl)cc2[N+](=O)[O-])nn1 |
| InChI | InChI=1S/C9H7Cl2N5O2/c10-5-1-7(11)9(8(2-5)16(17)18)15-4-6(3-12)13-14-15/h1-2,4H,3,12H2 |
| InChIKey | JQERAOPTKQQCOJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|