C10H5Cl2N3O5 — CID 43381249
1-(2,4-dichloro-6-nitrophenyl)-4-hydroxypyrazole-3-carboxylic acid (PubChem CID 43381249) has the molecular formula C10H5Cl2N3O5 and a molecular weight of 318.07 g/mol. Its IUPAC name is 1-(2,4-dichloro-6-nitrophenyl)-4-hydroxypyrazole-3-carboxylic acid.
| Compound Name | 1-(2,4-dichloro-6-nitrophenyl)-4-hydroxypyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 43381249 |
| Molecular Formula | C10H5Cl2N3O5 |
| Molecular Weight | 318.07 g/mol |
| Exact Mass | 316.96 |
| IUPAC Name | 1-(2,4-dichloro-6-nitrophenyl)-4-hydroxypyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(-c2c(Cl)cc(Cl)cc2[N+](=O)[O-])cc1O |
| InChI | InChI=1S/C10H5Cl2N3O5/c11-4-1-5(12)9(6(2-4)15(19)20)14-3-7(16)8(13-14)10(17)18/h1-3,16H,(H,17,18) |
| InChIKey | NGLJWVAOGZTTIS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.07 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|