2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid

C9H10N4O2S — CID 107461617

IUPAC2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid
SMILESCc1nc(Cn2cc(CC(=O)O)nn2)cs1
InChIInChI=1S/C9H10N4O2S/c1-6-10-8(5-16-6)4-13-3-7(11-12-13)2-9(14)15/h3,5H,2,4H2,1H3,(H,14,15)
InChIKeyNKVNZOSHTQPQTP-UHFFFAOYSA-N
MW238.27 g/mol
LogP0.72
Rot. Bonds4

About 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid

2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid (PubChem CID 107461617) has the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. Its IUPAC name is 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid
PubChem CID107461617
Molecular FormulaC9H10N4O2S
Molecular Weight238.27 g/mol
Exact Mass238.05
IUPAC Name2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid
SMILESCc1nc(Cn2cc(CC(=O)O)nn2)cs1
InChIInChI=1S/C9H10N4O2S/c1-6-10-8(5-16-6)4-13-3-7(11-12-13)2-9(14)15/h3,5H,2,4H2,1H3,(H,14,15)
InChIKeyNKVNZOSHTQPQTP-UHFFFAOYSA-N
XLogP0.72
TPSA80.90 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.27
LogP ≤ 50.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid?
The IUPAC name of 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid (CID 107461617) is 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid.
What is the SMILES notation for 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid?
The canonical SMILES for 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid is Cc1nc(Cn2cc(CC(=O)O)nn2)cs1.
What is the InChIKey of 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid?
The InChIKey is NKVNZOSHTQPQTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2S/c1-6-10-8(5-16-6)4-13-3-7(11-12-13)2-9(14)15/h3,5H,2,4H2,1H3,(H,14,15).
What are the key properties of 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid?
2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid has a molecular weight of 238.27 g/mol, XLogP of 0.72, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(2-methyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]acetic acid is sourced from PubChem (CID 107461617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).