C13H17FN4O2S — CID 107462572
3-(aminomethyl)-N-(3-ethyl-1-methylpyrazol-4-yl)-4-fluorobenzenesulfonamide (PubChem CID 107462572) has the molecular formula C13H17FN4O2S and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(3-ethyl-1-methylpyrazol-4-yl)-4-fluorobenzenesulfonamide.
| Compound Name | 3-(aminomethyl)-N-(3-ethyl-1-methylpyrazol-4-yl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 107462572 |
| Molecular Formula | C13H17FN4O2S |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-(aminomethyl)-N-(3-ethyl-1-methylpyrazol-4-yl)-4-fluorobenzenesulfonamide |
| SMILES | CCc1nn(C)cc1NS(=O)(=O)c1ccc(F)c(CN)c1 |
| InChI | InChI=1S/C13H17FN4O2S/c1-3-12-13(8-18(2)16-12)17-21(19,20)10-4-5-11(14)9(6-10)7-15/h4-6,8,17H,3,7,15H2,1-2H3 |
| InChIKey | GOUKOLVPMHIMKA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |