C10H12IN5 — CID 107463701
N-(3-ethyl-1-methylpyrazol-4-yl)-5-iodopyrimidin-4-amine (PubChem CID 107463701) has the molecular formula C10H12IN5 and a molecular weight of 329.15 g/mol. Its IUPAC name is N-(3-ethyl-1-methylpyrazol-4-yl)-5-iodopyrimidin-4-amine.
| Compound Name | N-(3-ethyl-1-methylpyrazol-4-yl)-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 107463701 |
| Molecular Formula | C10H12IN5 |
| Molecular Weight | 329.15 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | N-(3-ethyl-1-methylpyrazol-4-yl)-5-iodopyrimidin-4-amine |
| SMILES | CCc1nn(C)cc1Nc1ncncc1I |
| InChI | InChI=1S/C10H12IN5/c1-3-8-9(5-16(2)15-8)14-10-7(11)4-12-6-13-10/h4-6H,3H2,1-2H3,(H,12,13,14) |
| InChIKey | WAZPYMNPNGOAQU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.15 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|