C11H14ClN5 — CID 107464314
2-chloro-N-(3-ethyl-1-methylpyrazol-4-yl)-5-methylpyrimidin-4-amine (PubChem CID 107464314) has the molecular formula C11H14ClN5 and a molecular weight of 251.72 g/mol. Its IUPAC name is 2-chloro-N-(3-ethyl-1-methylpyrazol-4-yl)-5-methylpyrimidin-4-amine.
| Compound Name | 2-chloro-N-(3-ethyl-1-methylpyrazol-4-yl)-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107464314 |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-chloro-N-(3-ethyl-1-methylpyrazol-4-yl)-5-methylpyrimidin-4-amine |
| SMILES | CCc1nn(C)cc1Nc1nc(Cl)ncc1C |
| InChI | InChI=1S/C11H14ClN5/c1-4-8-9(6-17(3)16-8)14-10-7(2)5-13-11(12)15-10/h5-6H,4H2,1-3H3,(H,13,14,15) |
| InChIKey | JVRHAHMQRZSCMH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |