C15H26N4 — CID 107464891
2-(3-ethyl-1-methylpyrazol-4-yl)-3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 107464891) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-(3-ethyl-1-methylpyrazol-4-yl)-3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 2-(3-ethyl-1-methylpyrazol-4-yl)-3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 107464891 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 2-(3-ethyl-1-methylpyrazol-4-yl)-3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CCc1nn(C)cc1N1CC2CCCCN2CC1C |
| InChI | InChI=1S/C15H26N4/c1-4-14-15(11-17(3)16-14)19-10-13-7-5-6-8-18(13)9-12(19)2/h11-13H,4-10H2,1-3H3 |
| InChIKey | FDEHUEIICOXKED-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |