C12H18N4O2 — CID 107464990
6-ethyl-1-(3-ethyl-1-methylpyrazol-4-yl)piperazine-2,5-dione (PubChem CID 107464990) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-ethyl-1-(3-ethyl-1-methylpyrazol-4-yl)piperazine-2,5-dione.
| Compound Name | 6-ethyl-1-(3-ethyl-1-methylpyrazol-4-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 107464990 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 6-ethyl-1-(3-ethyl-1-methylpyrazol-4-yl)piperazine-2,5-dione |
| SMILES | CCc1nn(C)cc1N1C(=O)CNC(=O)C1CC |
| InChI | InChI=1S/C12H18N4O2/c1-4-8-10(7-15(3)14-8)16-9(5-2)12(18)13-6-11(16)17/h7,9H,4-6H2,1-3H3,(H,13,18) |
| InChIKey | QAZGJJOZZMSDKA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |