C14H10ClF3N2O — CID 107465510
N-(2-amino-5-chlorophenyl)-2,3,4-trifluoro-N-methylbenzamide (PubChem CID 107465510) has the molecular formula C14H10ClF3N2O and a molecular weight of 314.69 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-2,3,4-trifluoro-N-methylbenzamide.
| Compound Name | N-(2-amino-5-chlorophenyl)-2,3,4-trifluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 107465510 |
| Molecular Formula | C14H10ClF3N2O |
| Molecular Weight | 314.69 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-2,3,4-trifluoro-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(F)c(F)c1F)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C14H10ClF3N2O/c1-20(11-6-7(15)2-5-10(11)19)14(21)8-3-4-9(16)13(18)12(8)17/h2-6H,19H2,1H3 |
| InChIKey | WHMVGYOICGXKAC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.69 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|