C15H13ClN4O — CID 107465817
N-(2-amino-5-chlorophenyl)-N-methylpyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 107465817) has the molecular formula C15H13ClN4O and a molecular weight of 300.75 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-N-methylpyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-(2-amino-5-chlorophenyl)-N-methylpyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107465817 |
| Molecular Formula | C15H13ClN4O |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-N-methylpyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CN(C(=O)c1cnn2ccccc12)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C15H13ClN4O/c1-19(14-8-10(16)5-6-12(14)17)15(21)11-9-18-20-7-3-2-4-13(11)20/h2-9H,17H2,1H3 |
| InChIKey | TVYFKXVYAFQOAU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|