C12H13ClN4 — CID 107466001
4-chloro-2-N-methyl-2-N-(pyrimidin-2-ylmethyl)benzene-1,2-diamine (PubChem CID 107466001) has the molecular formula C12H13ClN4 and a molecular weight of 248.72 g/mol. Its IUPAC name is 4-chloro-2-N-methyl-2-N-(pyrimidin-2-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-methyl-2-N-(pyrimidin-2-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 107466001 |
| Molecular Formula | C12H13ClN4 |
| Molecular Weight | 248.72 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-chloro-2-N-methyl-2-N-(pyrimidin-2-ylmethyl)benzene-1,2-diamine |
| SMILES | CN(Cc1ncccn1)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C12H13ClN4/c1-17(8-12-15-5-2-6-16-12)11-7-9(13)3-4-10(11)14/h2-7H,8,14H2,1H3 |
| InChIKey | WZYYUEYYGZOZDA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.72 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|