C14H13Cl2FN2 — CID 107466083
4-chloro-2-N-[(2-chloro-3-fluorophenyl)methyl]-2-N-methylbenzene-1,2-diamine (PubChem CID 107466083) has the molecular formula C14H13Cl2FN2 and a molecular weight of 299.18 g/mol. Its IUPAC name is 4-chloro-2-N-[(2-chloro-3-fluorophenyl)methyl]-2-N-methylbenzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-[(2-chloro-3-fluorophenyl)methyl]-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 107466083 |
| Molecular Formula | C14H13Cl2FN2 |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4-chloro-2-N-[(2-chloro-3-fluorophenyl)methyl]-2-N-methylbenzene-1,2-diamine |
| SMILES | CN(Cc1cccc(F)c1Cl)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C14H13Cl2FN2/c1-19(13-7-10(15)5-6-12(13)18)8-9-3-2-4-11(17)14(9)16/h2-7H,8,18H2,1H3 |
| InChIKey | FUBDHTDCMVMQBZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|