C12H11N5O2 — CID 107466425
4-amino-N-(2-cyano-6-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 107466425) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-amino-N-(2-cyano-6-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N-(2-cyano-6-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 107466425 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-amino-N-(2-cyano-6-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1cccc(C#N)c1NC(=O)c1[nH]ncc1N |
| InChI | InChI=1S/C12H11N5O2/c1-19-9-4-2-3-7(5-13)10(9)16-12(18)11-8(14)6-15-17-11/h2-4,6H,14H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | GKSQPBJYTNLYKF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |