C13H11N5O2 — CID 107469830
6-amino-N-(2-cyano-6-methoxyphenyl)pyridazine-3-carboxamide (PubChem CID 107469830) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is 6-amino-N-(2-cyano-6-methoxyphenyl)pyridazine-3-carboxamide.
| Compound Name | 6-amino-N-(2-cyano-6-methoxyphenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 107469830 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 6-amino-N-(2-cyano-6-methoxyphenyl)pyridazine-3-carboxamide |
| SMILES | COc1cccc(C#N)c1NC(=O)c1ccc(N)nn1 |
| InChI | InChI=1S/C13H11N5O2/c1-20-10-4-2-3-8(7-14)12(10)16-13(19)9-5-6-11(15)18-17-9/h2-6H,1H3,(H2,15,18)(H,16,19) |
| InChIKey | SVPPHQMDLYGAMY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |