C15H12N4O2 — CID 107466505
2-[(4-amino-1,3-benzoxazol-2-yl)amino]-3-methoxybenzonitrile (PubChem CID 107466505) has the molecular formula C15H12N4O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 2-[(4-amino-1,3-benzoxazol-2-yl)amino]-3-methoxybenzonitrile.
| Compound Name | 2-[(4-amino-1,3-benzoxazol-2-yl)amino]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 107466505 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-[(4-amino-1,3-benzoxazol-2-yl)amino]-3-methoxybenzonitrile |
| SMILES | COc1cccc(C#N)c1Nc1nc2c(N)cccc2o1 |
| InChI | InChI=1S/C15H12N4O2/c1-20-11-6-2-4-9(8-16)13(11)18-15-19-14-10(17)5-3-7-12(14)21-15/h2-7H,17H2,1H3,(H,18,19) |
| InChIKey | BRJZPOBNPQCVAT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|