C14H18N2O3 — CID 107467227
1-[2-(aminomethyl)-6-methoxyphenyl]-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 107467227) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-6-methoxyphenyl]-3,3-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-(aminomethyl)-6-methoxyphenyl]-3,3-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 107467227 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-[2-(aminomethyl)-6-methoxyphenyl]-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | COc1cccc(CN)c1N1C(=O)CC(C)(C)C1=O |
| InChI | InChI=1S/C14H18N2O3/c1-14(2)7-11(17)16(13(14)18)12-9(8-15)5-4-6-10(12)19-3/h4-6H,7-8,15H2,1-3H3 |
| InChIKey | MYCZLOCEFBKFFZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|