C12H6BrF3N2O — CID 107470490
N-(2-bromo-6-fluorophenyl)-2,3-difluoropyridine-4-carboxamide (PubChem CID 107470490) has the molecular formula C12H6BrF3N2O and a molecular weight of 331.09 g/mol. Its IUPAC name is N-(2-bromo-6-fluorophenyl)-2,3-difluoropyridine-4-carboxamide.
| Compound Name | N-(2-bromo-6-fluorophenyl)-2,3-difluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 107470490 |
| Molecular Formula | C12H6BrF3N2O |
| Molecular Weight | 331.09 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | N-(2-bromo-6-fluorophenyl)-2,3-difluoropyridine-4-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1Br)c1ccnc(F)c1F |
| InChI | InChI=1S/C12H6BrF3N2O/c13-7-2-1-3-8(14)10(7)18-12(19)6-4-5-17-11(16)9(6)15/h1-5H,(H,18,19) |
| InChIKey | DFHRZZRVKBZFEK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.09 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|