C13H6BrF2N3O — CID 107470730
N-(5-bromo-2-cyanophenyl)-2,3-difluoropyridine-4-carboxamide (PubChem CID 107470730) has the molecular formula C13H6BrF2N3O and a molecular weight of 338.11 g/mol. Its IUPAC name is N-(5-bromo-2-cyanophenyl)-2,3-difluoropyridine-4-carboxamide.
| Compound Name | N-(5-bromo-2-cyanophenyl)-2,3-difluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 107470730 |
| Molecular Formula | C13H6BrF2N3O |
| Molecular Weight | 338.11 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | N-(5-bromo-2-cyanophenyl)-2,3-difluoropyridine-4-carboxamide |
| SMILES | N#Cc1ccc(Br)cc1NC(=O)c1ccnc(F)c1F |
| InChI | InChI=1S/C13H6BrF2N3O/c14-8-2-1-7(6-17)10(5-8)19-13(20)9-3-4-18-12(16)11(9)15/h1-5H,(H,19,20) |
| InChIKey | MPTGVVBPJOILCR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.11 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|