C16H34N2O — CID 107471112
2-(aminomethyl)-N,N-dibutyl-4,4-dimethylpentanamide (PubChem CID 107471112) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is 2-(aminomethyl)-N,N-dibutyl-4,4-dimethylpentanamide.
| Compound Name | 2-(aminomethyl)-N,N-dibutyl-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 107471112 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | 2-(aminomethyl)-N,N-dibutyl-4,4-dimethylpentanamide |
| SMILES | CCCCN(CCCC)C(=O)C(CN)CC(C)(C)C |
| InChI | InChI=1S/C16H34N2O/c1-6-8-10-18(11-9-7-2)15(19)14(13-17)12-16(3,4)5/h14H,6-13,17H2,1-5H3 |
| InChIKey | BQIRKXKLISMSLM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |