About 2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid
2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid (PubChem CID 107474919) has the molecular formula C14H23N3O3
and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid |
| PubChem CID | 107474919 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid |
| SMILES | CCOc1cc(NCC(CC(C)(C)C)C(=O)O)ncn1 |
| InChI | InChI=1S/C14H23N3O3/c1-5-20-12-6-11(16-9-17-12)15-8-10(13(18)19)7-14(2,3)4/h6,9-10H,5,7-8H2,1-4H3,(H,18,19)(H,15,16,17) |
| InChIKey | HOMQSEVIDNSIOG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid?
The IUPAC name of 2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid (CID 107474919) is 2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid.
What is the SMILES notation for 2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid?
The canonical SMILES for 2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid is CCOc1cc(NCC(CC(C)(C)C)C(=O)O)ncn1.
What is the InChIKey of 2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid?
The InChIKey is HOMQSEVIDNSIOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O3/c1-5-20-12-6-11(16-9-17-12)15-8-10(13(18)19)7-14(2,3)4/h6,9-10H,5,7-8H2,1-4H3,(H,18,19)(H,15,16,17).
What are the key properties of 2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid?
2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid has a molecular weight of 281.36 g/mol, XLogP of 2.42, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(6-ethoxypyrimidin-4-yl)amino]methyl]-4,4-dimethylpentanoic acid is sourced from PubChem (CID 107474919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).