About (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol
(2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol (PubChem CID 99606776) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol |
| PubChem CID | 99606776 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol |
| SMILES | CCOc1cc(NC[C@H](O)C(C)(C)C)ncn1 |
| InChI | InChI=1S/C12H21N3O2/c1-5-17-11-6-10(14-8-15-11)13-7-9(16)12(2,3)4/h6,8-9,16H,5,7H2,1-4H3,(H,13,14,15)/t9-/m0/s1 |
| InChIKey | CYVNUWPNCNGZNN-VIFPVBQESA-N |
| XLogP | 1.69 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol?
The IUPAC name of (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol (CID 99606776) is (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol.
What is the SMILES notation for (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol?
The canonical SMILES for (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol is CCOc1cc(NC[C@H](O)C(C)(C)C)ncn1.
What is the InChIKey of (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol?
The InChIKey is CYVNUWPNCNGZNN-VIFPVBQESA-N. The full InChI is InChI=1S/C12H21N3O2/c1-5-17-11-6-10(14-8-15-11)13-7-9(16)12(2,3)4/h6,8-9,16H,5,7H2,1-4H3,(H,13,14,15)/t9-/m0/s1.
What are the key properties of (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol?
(2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol has a molecular weight of 239.32 g/mol, XLogP of 1.69, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-3,3-dimethylbutan-2-ol is sourced from PubChem (CID 99606776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).