C14H28ClN7O3 — CID 44577031
2-[2-[4-[2-(dimethylamino)ethoxy]-6-(2-methoxyethylamino)pyrimidin-2-yl]oxyethyl]guanidine;hydrochloride (PubChem CID 44577031) has the molecular formula C14H28ClN7O3 and a molecular weight of 377.88 g/mol. Its IUPAC name is 2-[2-[4-[2-(dimethylamino)ethoxy]-6-(2-methoxyethylamino)pyrimidin-2-yl]oxyethyl]guanidine;hydrochloride.
| Compound Name | 2-[2-[4-[2-(dimethylamino)ethoxy]-6-(2-methoxyethylamino)pyrimidin-2-yl]oxyethyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 44577031 |
| Molecular Formula | C14H28ClN7O3 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-[2-[4-[2-(dimethylamino)ethoxy]-6-(2-methoxyethylamino)pyrimidin-2-yl]oxyethyl]guanidine;hydrochloride |
| SMILES | COCCNc1cc(OCCN(C)C)nc(OCCN=C(N)N)n1.Cl |
| InChI | InChI=1S/C14H27N7O3.ClH/c1-21(2)6-9-23-12-10-11(17-4-7-22-3)19-14(20-12)24-8-5-18-13(15)16;/h10H,4-9H2,1-3H3,(H4,15,16,18)(H,17,19,20);1H |
| InChIKey | ITVBOZHAUGAVQU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|