C19H38ClN7O3 — CID 44577029
2-[4-[6-[2-(dimethylamino)ethoxy]-2-(3-propan-2-yloxypropylamino)pyrimidin-4-yl]oxybutyl]guanidine;hydrochloride (PubChem CID 44577029) has the molecular formula C19H38ClN7O3 and a molecular weight of 448.01 g/mol. Its IUPAC name is 2-[4-[6-[2-(dimethylamino)ethoxy]-2-(3-propan-2-yloxypropylamino)pyrimidin-4-yl]oxybutyl]guanidine;hydrochloride.
| Compound Name | 2-[4-[6-[2-(dimethylamino)ethoxy]-2-(3-propan-2-yloxypropylamino)pyrimidin-4-yl]oxybutyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 44577029 |
| Molecular Formula | C19H38ClN7O3 |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 2-[4-[6-[2-(dimethylamino)ethoxy]-2-(3-propan-2-yloxypropylamino)pyrimidin-4-yl]oxybutyl]guanidine;hydrochloride |
| SMILES | CC(C)OCCCNc1nc(OCCCCN=C(N)N)cc(OCCN(C)C)n1.Cl |
| InChI | InChI=1S/C19H37N7O3.ClH/c1-15(2)27-12-7-9-23-19-24-16(28-11-6-5-8-22-18(20)21)14-17(25-19)29-13-10-26(3)4;/h14-15H,5-13H2,1-4H3,(H4,20,21,22)(H,23,24,25);1H |
| InChIKey | KIRACHHIWPXGCS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|