C17H31N7O3 — CID 155201884
5-N-[4-(diaminomethylideneamino)butyl]-2-N-(4-propan-2-yloxybutyl)-1H-imidazole-2,5-dicarboxamide (PubChem CID 155201884) has the molecular formula C17H31N7O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 5-N-[4-(diaminomethylideneamino)butyl]-2-N-(4-propan-2-yloxybutyl)-1H-imidazole-2,5-dicarboxamide.
| Compound Name | 5-N-[4-(diaminomethylideneamino)butyl]-2-N-(4-propan-2-yloxybutyl)-1H-imidazole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 155201884 |
| Molecular Formula | C17H31N7O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 5-N-[4-(diaminomethylideneamino)butyl]-2-N-(4-propan-2-yloxybutyl)-1H-imidazole-2,5-dicarboxamide |
| SMILES | CC(C)OCCCCNC(=O)c1ncc(C(=O)NCCCCN=C(N)N)[nH]1 |
| InChI | InChI=1S/C17H31N7O3/c1-12(2)27-10-6-5-8-21-16(26)14-23-11-13(24-14)15(25)20-7-3-4-9-22-17(18)19/h11-12H,3-10H2,1-2H3,(H,20,25)(H,21,26)(H,23,24)(H4,18,19,22) |
| InChIKey | ATXQYXXBNYBZCY-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 160.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|