C13H19N3O — CID 107475304
3-(2,2-dimethylpropyl)-1,3,4,5-tetrahydropyrido[2,3-b][1,4]diazepin-2-one (PubChem CID 107475304) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-1,3,4,5-tetrahydropyrido[2,3-b][1,4]diazepin-2-one.
| Compound Name | 3-(2,2-dimethylpropyl)-1,3,4,5-tetrahydropyrido[2,3-b][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 107475304 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-1,3,4,5-tetrahydropyrido[2,3-b][1,4]diazepin-2-one |
| SMILES | CC(C)(C)CC1CNc2ncccc2NC1=O |
| InChI | InChI=1S/C13H19N3O/c1-13(2,3)7-9-8-15-11-10(16-12(9)17)5-4-6-14-11/h4-6,9H,7-8H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | LBLKKOHVUSOBPW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |