C13H16ClF2NO — CID 107476133
1-(2-chloro-4,5-difluorophenyl)-N-methyl-1-(2-methyloxolan-3-yl)methanamine (PubChem CID 107476133) has the molecular formula C13H16ClF2NO and a molecular weight of 275.73 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-N-methyl-1-(2-methyloxolan-3-yl)methanamine.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-N-methyl-1-(2-methyloxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 107476133 |
| Molecular Formula | C13H16ClF2NO |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-N-methyl-1-(2-methyloxolan-3-yl)methanamine |
| SMILES | CNC(c1cc(F)c(F)cc1Cl)C1CCOC1C |
| InChI | InChI=1S/C13H16ClF2NO/c1-7-8(3-4-18-7)13(17-2)9-5-11(15)12(16)6-10(9)14/h5-8,13,17H,3-4H2,1-2H3 |
| InChIKey | REXHGDSHYFLNSU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|