C17H16ClF2N — CID 107476284
1-(2-chloro-4,5-difluorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)-N-methylmethanamine (PubChem CID 107476284) has the molecular formula C17H16ClF2N and a molecular weight of 307.77 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)-N-methylmethanamine.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107476284 |
| Molecular Formula | C17H16ClF2N |
| Molecular Weight | 307.77 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-1-(2,3-dihydro-1H-inden-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc(F)c(F)cc1Cl)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H16ClF2N/c1-21-17(13-8-15(19)16(20)9-14(13)18)12-6-10-4-2-3-5-11(10)7-12/h2-5,8-9,12,17,21H,6-7H2,1H3 |
| InChIKey | JTHOOBHXGZIKNN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.77 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|