C16H12Cl2F2 — CID 107477400
2-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-2,3-dihydro-1H-indene (PubChem CID 107477400) has the molecular formula C16H12Cl2F2 and a molecular weight of 313.17 g/mol. Its IUPAC name is 2-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-2,3-dihydro-1H-indene.
| Compound Name | 2-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 107477400 |
| Molecular Formula | C16H12Cl2F2 |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-2,3-dihydro-1H-indene |
| SMILES | Fc1cc(Cl)c(C(Cl)C2Cc3ccccc3C2)cc1F |
| InChI | InChI=1S/C16H12Cl2F2/c17-13-8-15(20)14(19)7-12(13)16(18)11-5-9-3-1-2-4-10(9)6-11/h1-4,7-8,11,16H,5-6H2 |
| InChIKey | VUATVKDFLJWINP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|