C18H19ClO2 — CID 106893752
2-[chloro-(2,5-dimethoxyphenyl)methyl]-2,3-dihydro-1H-indene (PubChem CID 106893752) has the molecular formula C18H19ClO2 and a molecular weight of 302.80 g/mol. Its IUPAC name is 2-[chloro-(2,5-dimethoxyphenyl)methyl]-2,3-dihydro-1H-indene.
| Compound Name | 2-[chloro-(2,5-dimethoxyphenyl)methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 106893752 |
| Molecular Formula | C18H19ClO2 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[chloro-(2,5-dimethoxyphenyl)methyl]-2,3-dihydro-1H-indene |
| SMILES | COc1ccc(OC)c(C(Cl)C2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C18H19ClO2/c1-20-15-7-8-17(21-2)16(11-15)18(19)14-9-12-5-3-4-6-13(12)10-14/h3-8,11,14,18H,9-10H2,1-2H3 |
| InChIKey | PRMZSXSHOWLGFY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|