C19H23NO2 — CID 119164773
N-[1-(2,5-dimethoxyphenyl)ethyl]-2,3-dihydro-1H-inden-2-amine (PubChem CID 119164773) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[1-(2,5-dimethoxyphenyl)ethyl]-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 119164773 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-2,3-dihydro-1H-inden-2-amine |
| SMILES | COc1ccc(OC)c(C(C)NC2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C19H23NO2/c1-13(18-12-17(21-2)8-9-19(18)22-3)20-16-10-14-6-4-5-7-15(14)11-16/h4-9,12-13,16,20H,10-11H2,1-3H3 |
| InChIKey | QAQVOMCVYKJHOE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |