C11H20F2N2O2 — CID 107479082
3-cyclohexyl-1-(2,2-difluoroethyl)-1-(2-hydroxyethyl)urea (PubChem CID 107479082) has the molecular formula C11H20F2N2O2 and a molecular weight of 250.29 g/mol. Its IUPAC name is 3-cyclohexyl-1-(2,2-difluoroethyl)-1-(2-hydroxyethyl)urea.
| Compound Name | 3-cyclohexyl-1-(2,2-difluoroethyl)-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 107479082 |
| Molecular Formula | C11H20F2N2O2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-cyclohexyl-1-(2,2-difluoroethyl)-1-(2-hydroxyethyl)urea |
| SMILES | O=C(NC1CCCCC1)N(CCO)CC(F)F |
| InChI | InChI=1S/C11H20F2N2O2/c12-10(13)8-15(6-7-16)11(17)14-9-4-2-1-3-5-9/h9-10,16H,1-8H2,(H,14,17) |
| InChIKey | LBBOHIMMOYXRMY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |