C8H9ClF2N2O5S2 — CID 107479243
5-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-nitrothiophene-2-sulfonamide (PubChem CID 107479243) has the molecular formula C8H9ClF2N2O5S2 and a molecular weight of 350.75 g/mol. Its IUPAC name is 5-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107479243 |
| Molecular Formula | C8H9ClF2N2O5S2 |
| Molecular Weight | 350.75 g/mol |
| Exact Mass | 349.96 |
| IUPAC Name | 5-chloro-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-4-nitrothiophene-2-sulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N(CCO)CC(F)F)sc1Cl |
| InChI | InChI=1S/C8H9ClF2N2O5S2/c9-8-5(13(15)16)3-7(19-8)20(17,18)12(1-2-14)4-6(10)11/h3,6,14H,1-2,4H2 |
| InChIKey | UHUKIFQVCXSHFF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.75 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|