C9H8ClF3N2O4S2 — CID 80735432
5-chloro-N-cyclopropyl-4-nitro-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide (PubChem CID 80735432) has the molecular formula C9H8ClF3N2O4S2 and a molecular weight of 364.75 g/mol. Its IUPAC name is 5-chloro-N-cyclopropyl-4-nitro-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-cyclopropyl-4-nitro-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80735432 |
| Molecular Formula | C9H8ClF3N2O4S2 |
| Molecular Weight | 364.75 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 5-chloro-N-cyclopropyl-4-nitro-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N(CC(F)(F)F)C2CC2)sc1Cl |
| InChI | InChI=1S/C9H8ClF3N2O4S2/c10-8-6(15(16)17)3-7(20-8)21(18,19)14(5-1-2-5)4-9(11,12)13/h3,5H,1-2,4H2 |
| InChIKey | MALAELMZKKWNLB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.75 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|