C8H14F2N2O — CID 107479678
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile (PubChem CID 107479678) has the molecular formula C8H14F2N2O and a molecular weight of 192.21 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile.
| Compound Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile |
|---|---|
| PubChem CID | 107479678 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanenitrile |
| SMILES | N#CCCCN(CCO)CC(F)F |
| InChI | InChI=1S/C8H14F2N2O/c9-8(10)7-12(5-6-13)4-2-1-3-11/h8,13H,1-2,4-7H2 |
| InChIKey | NMOZUFBJFRLPGW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|