C9H18F3N3O2 — CID 107480165
N'-hydroxy-5-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]pentanimidamide (PubChem CID 107480165) has the molecular formula C9H18F3N3O2 and a molecular weight of 257.26 g/mol. Its IUPAC name is N'-hydroxy-5-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]pentanimidamide.
| Compound Name | N'-hydroxy-5-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]pentanimidamide |
|---|---|
| PubChem CID | 107480165 |
| Molecular Formula | C9H18F3N3O2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N'-hydroxy-5-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]pentanimidamide |
| SMILES | NC(CCCCN(CCO)CC(F)(F)F)=NO |
| InChI | InChI=1S/C9H18F3N3O2/c10-9(11,12)7-15(5-6-16)4-2-1-3-8(13)14-17/h16-17H,1-7H2,(H2,13,14) |
| InChIKey | GPTMAKBOSDQOSW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|