C6H11F3N4O — CID 107484811
2-[2-azidoethyl(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 107484811) has the molecular formula C6H11F3N4O and a molecular weight of 212.17 g/mol. Its IUPAC name is 2-[2-azidoethyl(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 2-[2-azidoethyl(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107484811 |
| Molecular Formula | C6H11F3N4O |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-[2-azidoethyl(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | [N-]=[N+]=NCCN(CCO)CC(F)(F)F |
| InChI | InChI=1S/C6H11F3N4O/c7-6(8,9)5-13(3-4-14)2-1-11-12-10/h14H,1-5H2 |
| InChIKey | LCVCGDZHCKENDE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|