C11H13ClF3N3O — CID 107480225
2-chloro-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide (PubChem CID 107480225) has the molecular formula C11H13ClF3N3O and a molecular weight of 295.69 g/mol. Its IUPAC name is 2-chloro-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide.
| Compound Name | 2-chloro-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 107480225 |
| Molecular Formula | C11H13ClF3N3O |
| Molecular Weight | 295.69 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-chloro-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(Cl)cccc1N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C11H13ClF3N3O/c12-7-2-1-3-8(9(7)10(16)17)18(4-5-19)6-11(13,14)15/h1-3,19H,4-6H2,(H3,16,17) |
| InChIKey | QLCVUWPSFHXSCX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.69 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|