C12H15F4N3 — CID 79519200
2-fluoro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide (PubChem CID 79519200) has the molecular formula C12H15F4N3 and a molecular weight of 277.26 g/mol. Its IUPAC name is 2-fluoro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide.
| Compound Name | 2-fluoro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 79519200 |
| Molecular Formula | C12H15F4N3 |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-fluoro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(F)cccc1N(CCC)CC(F)(F)F |
| InChI | InChI=1S/C12H15F4N3/c1-2-6-19(7-12(14,15)16)9-5-3-4-8(13)10(9)11(17)18/h3-5H,2,6-7H2,1H3,(H3,17,18) |
| InChIKey | RGFCNEHSMKMWLZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|