C10H14F3N5 — CID 112755775
4-[propyl(2,2,2-trifluoroethyl)amino]pyrimidine-5-carboximidamide (PubChem CID 112755775) has the molecular formula C10H14F3N5 and a molecular weight of 261.25 g/mol. Its IUPAC name is 4-[propyl(2,2,2-trifluoroethyl)amino]pyrimidine-5-carboximidamide.
| Compound Name | 4-[propyl(2,2,2-trifluoroethyl)amino]pyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 112755775 |
| Molecular Formula | C10H14F3N5 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 4-[propyl(2,2,2-trifluoroethyl)amino]pyrimidine-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cncnc1N(CCC)CC(F)(F)F |
| InChI | InChI=1S/C10H14F3N5/c1-2-3-18(5-10(11,12)13)9-7(8(14)15)4-16-6-17-9/h4,6H,2-3,5H2,1H3,(H3,14,15) |
| InChIKey | VNQSIJVMEVMAFE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|