C12H18FN3 — CID 79519709
2-fluoro-6-[methyl(2-methylpropyl)amino]benzenecarboximidamide (PubChem CID 79519709) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is 2-fluoro-6-[methyl(2-methylpropyl)amino]benzenecarboximidamide.
| Compound Name | 2-fluoro-6-[methyl(2-methylpropyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 79519709 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 2-fluoro-6-[methyl(2-methylpropyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(F)cccc1N(C)CC(C)C |
| InChI | InChI=1S/C12H18FN3/c1-8(2)7-16(3)10-6-4-5-9(13)11(10)12(14)15/h4-6,8H,7H2,1-3H3,(H3,14,15) |
| InChIKey | YZYYMQKAUSIEMX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|