C11H16F2N4O — CID 107480262
4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]pyridine-2-carboximidamide (PubChem CID 107480262) has the molecular formula C11H16F2N4O and a molecular weight of 258.27 g/mol. Its IUPAC name is 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]pyridine-2-carboximidamide.
| Compound Name | 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 107480262 |
| Molecular Formula | C11H16F2N4O |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 4-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(CN(CCO)CC(F)F)ccn1 |
| InChI | InChI=1S/C11H16F2N4O/c12-10(13)7-17(3-4-18)6-8-1-2-16-9(5-8)11(14)15/h1-2,5,10,18H,3-4,6-7H2,(H3,14,15) |
| InChIKey | RUOQRZVGLVTZOY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|