C8H17F2N3O — CID 107480269
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanimidamide (PubChem CID 107480269) has the molecular formula C8H17F2N3O and a molecular weight of 209.24 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanimidamide.
| Compound Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanimidamide |
|---|---|
| PubChem CID | 107480269 |
| Molecular Formula | C8H17F2N3O |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]butanimidamide |
| SMILES | [H]/N=C(\N)CCCN(CCO)CC(F)F |
| InChI | InChI=1S/C8H17F2N3O/c9-7(10)6-13(4-5-14)3-1-2-8(11)12/h7,14H,1-6H2,(H3,11,12) |
| InChIKey | CNGDQLQBRUHFMJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|