C8H16F3N3O — CID 107480297
4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanimidamide (PubChem CID 107480297) has the molecular formula C8H16F3N3O and a molecular weight of 227.23 g/mol. Its IUPAC name is 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanimidamide.
| Compound Name | 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanimidamide |
|---|---|
| PubChem CID | 107480297 |
| Molecular Formula | C8H16F3N3O |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]butanimidamide |
| SMILES | [H]/N=C(\N)CCCN(CCO)CC(F)(F)F |
| InChI | InChI=1S/C8H16F3N3O/c9-8(10,11)6-14(4-5-15)3-1-2-7(12)13/h15H,1-6H2,(H3,12,13) |
| InChIKey | LYGVESYKGZPUJE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|