C9H15F2NO3 — CID 107480772
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2-methylbut-2-enoic acid (PubChem CID 107480772) has the molecular formula C9H15F2NO3 and a molecular weight of 223.22 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2-methylbut-2-enoic acid.
| Compound Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 107480772 |
| Molecular Formula | C9H15F2NO3 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2-methylbut-2-enoic acid |
| SMILES | CC(=CCN(CCO)CC(F)F)C(=O)O |
| InChI | InChI=1S/C9H15F2NO3/c1-7(9(14)15)2-3-12(4-5-13)6-8(10)11/h2,8,13H,3-6H2,1H3,(H,14,15) |
| InChIKey | KMWZGNMNWWROHZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|