C11H20F2N2O5 — CID 107481824
2-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]-5-methoxypentanoic acid (PubChem CID 107481824) has the molecular formula C11H20F2N2O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]-5-methoxypentanoic acid.
| Compound Name | 2-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 107481824 |
| Molecular Formula | C11H20F2N2O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-[[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]amino]-5-methoxypentanoic acid |
| SMILES | COCCCC(NC(=O)N(CCO)CC(F)F)C(=O)O |
| InChI | InChI=1S/C11H20F2N2O5/c1-20-6-2-3-8(10(17)18)14-11(19)15(4-5-16)7-9(12)13/h8-9,16H,2-7H2,1H3,(H,14,19)(H,17,18) |
| InChIKey | UOTFOYUPXVMNGL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|