About ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate
ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate (PubChem CID 107482272) has the molecular formula C11H14F2N2O4S
and a molecular weight of 308.31 g/mol. Its IUPAC name is ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate |
| PubChem CID | 107482272 |
| Molecular Formula | C11H14F2N2O4S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(C(=O)N(CCO)CC(F)F)cs1 |
| InChI | InChI=1S/C11H14F2N2O4S/c1-2-19-11(18)9-14-7(6-20-9)10(17)15(3-4-16)5-8(12)13/h6,8,16H,2-5H2,1H3 |
| InChIKey | UESZNQGZBCXVCH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate?
The IUPAC name of ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate (CID 107482272) is ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate.
What is the SMILES notation for ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate?
The canonical SMILES for ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate is CCOC(=O)c1nc(C(=O)N(CCO)CC(F)F)cs1.
What is the InChIKey of ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate?
The InChIKey is UESZNQGZBCXVCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2N2O4S/c1-2-19-11(18)9-14-7(6-20-9)10(17)15(3-4-16)5-8(12)13/h6,8,16H,2-5H2,1H3.
What are the key properties of ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate?
ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate has a molecular weight of 308.31 g/mol, XLogP of 1.02, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2,2-difluoroethyl(2-hydroxyethyl)carbamoyl]-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 107482272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).