C12H23F2NO2 — CID 107482685
N-(2,2-difluoroethyl)-2-ethyl-N-(2-hydroxyethyl)hexanamide (PubChem CID 107482685) has the molecular formula C12H23F2NO2 and a molecular weight of 251.32 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-ethyl-N-(2-hydroxyethyl)hexanamide.
| Compound Name | N-(2,2-difluoroethyl)-2-ethyl-N-(2-hydroxyethyl)hexanamide |
|---|---|
| PubChem CID | 107482685 |
| Molecular Formula | C12H23F2NO2 |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-ethyl-N-(2-hydroxyethyl)hexanamide |
| SMILES | CCCCC(CC)C(=O)N(CCO)CC(F)F |
| InChI | InChI=1S/C12H23F2NO2/c1-3-5-6-10(4-2)12(17)15(7-8-16)9-11(13)14/h10-11,16H,3-9H2,1-2H3 |
| InChIKey | HKBULBLALHWPNA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |